C17H16BrNO3S — CID 55329737
(E)-3-(5-bromothiophen-2-yl)-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N-methylprop-2-enamide (PubChem CID 55329737) has the molecular formula C17H16BrNO3S and a molecular weight of 394.29 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N-methylprop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 55329737 |
| Molecular Formula | C17H16BrNO3S |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N-methylprop-2-enamide |
| SMILES | CN(CC1COc2ccccc2O1)C(=O)/C=C/c1ccc(Br)s1 |
| InChI | InChI=1S/C17H16BrNO3S/c1-19(17(20)9-7-13-6-8-16(18)23-13)10-12-11-21-14-4-2-3-5-15(14)22-12/h2-9,12H,10-11H2,1H3/b9-7+ |
| InChIKey | WNUBEHVHOBAABP-VQHVLOKHSA-N |
| XLogP | 3.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|