C24H29F3N4O — CID 30575872
N-[(2R)-2-(1-methyl-2,3-dihydroindol-5-yl)-2-(4-methylpiperazin-1-yl)ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 30575872) has the molecular formula C24H29F3N4O and a molecular weight of 446.52 g/mol. Its IUPAC name is N-[(2R)-2-(1-methyl-2,3-dihydroindol-5-yl)-2-(4-methylpiperazin-1-yl)ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[(2R)-2-(1-methyl-2,3-dihydroindol-5-yl)-2-(4-methylpiperazin-1-yl)ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 30575872 |
| Molecular Formula | C24H29F3N4O |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | N-[(2R)-2-(1-methyl-2,3-dihydroindol-5-yl)-2-(4-methylpiperazin-1-yl)ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | CN1CCN([C@@H](CNC(=O)c2ccc(C(F)(F)F)cc2)c2ccc3c(c2)CCN3C)CC1 |
| InChI | InChI=1S/C24H29F3N4O/c1-29-11-13-31(14-12-29)22(18-5-8-21-19(15-18)9-10-30(21)2)16-28-23(32)17-3-6-20(7-4-17)24(25,26)27/h3-8,15,22H,9-14,16H2,1-2H3,(H,28,32)/t22-/m0/s1 |
| InChIKey | YSYWMTVUGSVVBU-QFIPXVFZSA-N |
| XLogP | 3.42 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|