C23H30FN5O — CID 51696860
1-(4-fluorophenyl)-3-[(2R)-2-(1-methyl-2,3-dihydroindol-5-yl)-2-(4-methylpiperazin-1-yl)ethyl]urea (PubChem CID 51696860) has the molecular formula C23H30FN5O and a molecular weight of 411.53 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[(2R)-2-(1-methyl-2,3-dihydroindol-5-yl)-2-(4-methylpiperazin-1-yl)ethyl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[(2R)-2-(1-methyl-2,3-dihydroindol-5-yl)-2-(4-methylpiperazin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 51696860 |
| Molecular Formula | C23H30FN5O |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[(2R)-2-(1-methyl-2,3-dihydroindol-5-yl)-2-(4-methylpiperazin-1-yl)ethyl]urea |
| SMILES | CN1CCN([C@@H](CNC(=O)Nc2ccc(F)cc2)c2ccc3c(c2)CCN3C)CC1 |
| InChI | InChI=1S/C23H30FN5O/c1-27-11-13-29(14-12-27)22(17-3-8-21-18(15-17)9-10-28(21)2)16-25-23(30)26-20-6-4-19(24)5-7-20/h3-8,15,22H,9-14,16H2,1-2H3,(H2,25,26,30)/t22-/m0/s1 |
| InChIKey | MYMJCNGKUWIZJJ-QFIPXVFZSA-N |
| XLogP | 2.93 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|