C22H24BrCl2N3O2 — CID 3059367
4-amino-5-bromo-N-[8-[(3,4-dichlorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-2-methoxybenzamide (PubChem CID 3059367) has the molecular formula C22H24BrCl2N3O2 and a molecular weight of 513.26 g/mol. Its IUPAC name is 4-amino-5-bromo-N-[8-[(3,4-dichlorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-2-methoxybenzamide.
| Compound Name | 4-amino-5-bromo-N-[8-[(3,4-dichlorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 3059367 |
| Molecular Formula | C22H24BrCl2N3O2 |
| Molecular Weight | 513.26 g/mol |
| Exact Mass | 511.04 |
| IUPAC Name | 4-amino-5-bromo-N-[8-[(3,4-dichlorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]-2-methoxybenzamide |
| SMILES | COc1cc(N)c(Br)cc1C(=O)NC1CC2CCC(C1)N2Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H24BrCl2N3O2/c1-30-21-10-20(26)17(23)9-16(21)22(29)27-13-7-14-3-4-15(8-13)28(14)11-12-2-5-18(24)19(25)6-12/h2,5-6,9-10,13-15H,3-4,7-8,11,26H2,1H3,(H,27,29) |
| InChIKey | BFOLUERZXGCFFW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.26 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|