C23H27N5O3S — CID 30596083
2-ethoxy-N-[3-[6-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenyl]benzenesulfonamide (PubChem CID 30596083) has the molecular formula C23H27N5O3S and a molecular weight of 453.57 g/mol. Its IUPAC name is 2-ethoxy-N-[3-[6-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenyl]benzenesulfonamide.
| Compound Name | 2-ethoxy-N-[3-[6-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 30596083 |
| Molecular Formula | C23H27N5O3S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 2-ethoxy-N-[3-[6-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenyl]benzenesulfonamide |
| SMILES | CCOc1ccccc1S(=O)(=O)Nc1cccc(-c2ccc(N3CCN(C)CC3)nn2)c1 |
| InChI | InChI=1S/C23H27N5O3S/c1-3-31-21-9-4-5-10-22(21)32(29,30)26-19-8-6-7-18(17-19)20-11-12-23(25-24-20)28-15-13-27(2)14-16-28/h4-12,17,26H,3,13-16H2,1-2H3 |
| InChIKey | OYDYSEUBHAQNMD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |