C24H27N5O5S — CID 30596881
1,3-dimethyl-6-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazine-1-carbonyl]pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 30596881) has the molecular formula C24H27N5O5S and a molecular weight of 497.58 g/mol. Its IUPAC name is 1,3-dimethyl-6-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazine-1-carbonyl]pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-6-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazine-1-carbonyl]pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 30596881 |
| Molecular Formula | C24H27N5O5S |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 1,3-dimethyl-6-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazine-1-carbonyl]pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)c2cc(C(=O)N3CCN(S(=O)(=O)c4ccc5c(c4)CCCC5)CC3)cnc2n(C)c1=O |
| InChI | InChI=1S/C24H27N5O5S/c1-26-21-20(23(31)27(2)24(26)32)14-18(15-25-21)22(30)28-9-11-29(12-10-28)35(33,34)19-8-7-16-5-3-4-6-17(16)13-19/h7-8,13-15H,3-6,9-12H2,1-2H3 |
| InChIKey | OFKZUNLHKPVOOC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 114.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |