C18H22ClN3O2S — CID 30606396
1-(5-chloro-2-methoxyphenyl)-3-[(2S)-2-pyrrolidin-1-yl-2-thiophen-3-ylethyl]urea (PubChem CID 30606396) has the molecular formula C18H22ClN3O2S and a molecular weight of 379.91 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-[(2S)-2-pyrrolidin-1-yl-2-thiophen-3-ylethyl]urea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-[(2S)-2-pyrrolidin-1-yl-2-thiophen-3-ylethyl]urea |
|---|---|
| PubChem CID | 30606396 |
| Molecular Formula | C18H22ClN3O2S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-[(2S)-2-pyrrolidin-1-yl-2-thiophen-3-ylethyl]urea |
| SMILES | COc1ccc(Cl)cc1NC(=O)NC[C@H](c1ccsc1)N1CCCC1 |
| InChI | InChI=1S/C18H22ClN3O2S/c1-24-17-5-4-14(19)10-15(17)21-18(23)20-11-16(13-6-9-25-12-13)22-7-2-3-8-22/h4-6,9-10,12,16H,2-3,7-8,11H2,1H3,(H2,20,21,23)/t16-/m1/s1 |
| InChIKey | WTUMZCIYHAPMHF-MRXNPFEDSA-N |
| XLogP | 4.37 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |