C19H15BrO3 — CID 30619127
2-bromo-2-[(1R)-3-oxo-1-phenylbutyl]indene-1,3-dione (PubChem CID 30619127) has the molecular formula C19H15BrO3 and a molecular weight of 371.23 g/mol. Its IUPAC name is 2-bromo-2-[(1R)-3-oxo-1-phenylbutyl]indene-1,3-dione.
| Compound Name | 2-bromo-2-[(1R)-3-oxo-1-phenylbutyl]indene-1,3-dione |
|---|---|
| PubChem CID | 30619127 |
| Molecular Formula | C19H15BrO3 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 2-bromo-2-[(1R)-3-oxo-1-phenylbutyl]indene-1,3-dione |
| SMILES | CC(=O)C[C@H](c1ccccc1)C1(Br)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H15BrO3/c1-12(21)11-16(13-7-3-2-4-8-13)19(20)17(22)14-9-5-6-10-15(14)18(19)23/h2-10,16H,11H2,1H3/t16-/m1/s1 |
| InChIKey | ZIPQVCOBTBIFIP-MRXNPFEDSA-N |
| XLogP | 3.96 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|