C26H20Br2O3 — CID 4626019
2-bromo-2-[2-bromo-3-(4-ethylphenyl)-3-oxo-1-phenylpropyl]indene-1,3-dione (PubChem CID 4626019) has the molecular formula C26H20Br2O3 and a molecular weight of 540.25 g/mol. Its IUPAC name is 2-bromo-2-[2-bromo-3-(4-ethylphenyl)-3-oxo-1-phenylpropyl]indene-1,3-dione.
| Compound Name | 2-bromo-2-[2-bromo-3-(4-ethylphenyl)-3-oxo-1-phenylpropyl]indene-1,3-dione |
|---|---|
| PubChem CID | 4626019 |
| Molecular Formula | C26H20Br2O3 |
| Molecular Weight | 540.25 g/mol |
| Exact Mass | 537.98 |
| IUPAC Name | 2-bromo-2-[2-bromo-3-(4-ethylphenyl)-3-oxo-1-phenylpropyl]indene-1,3-dione |
| SMILES | CCc1ccc(C(=O)C(Br)C(c2ccccc2)C2(Br)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C26H20Br2O3/c1-2-16-12-14-18(15-13-16)23(29)22(27)21(17-8-4-3-5-9-17)26(28)24(30)19-10-6-7-11-20(19)25(26)31/h3-15,21-22H,2H2,1H3 |
| InChIKey | QSEZLRZNZFDQBO-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.25 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|