C16H14Br2O — CID 3008754
2,2-dibromo-1-[4-(2-phenylethyl)phenyl]ethanone (PubChem CID 3008754) has the molecular formula C16H14Br2O and a molecular weight of 382.10 g/mol. Its IUPAC name is 2,2-dibromo-1-[4-(2-phenylethyl)phenyl]ethanone.
| Compound Name | 2,2-dibromo-1-[4-(2-phenylethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 3008754 |
| Molecular Formula | C16H14Br2O |
| Molecular Weight | 382.10 g/mol |
| Exact Mass | 379.94 |
| IUPAC Name | 2,2-dibromo-1-[4-(2-phenylethyl)phenyl]ethanone |
| SMILES | O=C(c1ccc(CCc2ccccc2)cc1)C(Br)Br |
| InChI | InChI=1S/C16H14Br2O/c17-16(18)15(19)14-10-8-13(9-11-14)7-6-12-4-2-1-3-5-12/h1-5,8-11,16H,6-7H2 |
| InChIKey | ANMMPNYQAYHGLH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.10 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|