C27H36N6OS — CID 30636430
2-[4-[2-[(7R)-4-amino-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethyl]piperazin-1-yl]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 30636430) has the molecular formula C27H36N6OS and a molecular weight of 492.69 g/mol. Its IUPAC name is 2-[4-[2-[(7R)-4-amino-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethyl]piperazin-1-yl]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[4-[2-[(7R)-4-amino-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethyl]piperazin-1-yl]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 30636430 |
| Molecular Formula | C27H36N6OS |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | 2-[4-[2-[(7R)-4-amino-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethyl]piperazin-1-yl]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CN2CCN(CCc3nc(N)c4c5c(sc4n3)C[C@H](C)CC5)CC2)c1C |
| InChI | InChI=1S/C27H36N6OS/c1-17-7-8-20-22(15-17)35-27-25(20)26(28)30-23(31-27)9-10-32-11-13-33(14-12-32)16-24(34)29-21-6-4-5-18(2)19(21)3/h4-6,17H,7-16H2,1-3H3,(H,29,34)(H2,28,30,31)/t17-/m1/s1 |
| InChIKey | RYQFPVRXKXHVSX-QGZVFWFLSA-N |
| XLogP | 3.81 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |