C26H34N6OS — CID 34708214
2-[4-[(3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl]piperazin-1-yl]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 34708214) has the molecular formula C26H34N6OS and a molecular weight of 478.67 g/mol. Its IUPAC name is 2-[4-[(3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl]piperazin-1-yl]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[4-[(3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl]piperazin-1-yl]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 34708214 |
| Molecular Formula | C26H34N6OS |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | 2-[4-[(3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl]piperazin-1-yl]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CN2CCN(Cc3nc(N)c4c5c(sc4n3)CCCCC5)CC2)c1C |
| InChI | InChI=1S/C26H34N6OS/c1-17-7-6-9-20(18(17)2)28-23(33)16-32-13-11-31(12-14-32)15-22-29-25(27)24-19-8-4-3-5-10-21(19)34-26(24)30-22/h6-7,9H,3-5,8,10-16H2,1-2H3,(H,28,33)(H2,27,29,30) |
| InChIKey | XVQHJYSWIVZCNA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |