C13H28Cl2N2O2 — CID 3063980
N',N'-bis(2-chloroethyl)-N,N-diethylpentane-1,5-diamine oxide (PubChem CID 3063980) has the molecular formula C13H28Cl2N2O2 and a molecular weight of 315.29 g/mol. Its IUPAC name is N',N'-bis(2-chloroethyl)-N,N-diethylpentane-1,5-diamine oxide.
| Compound Name | N',N'-bis(2-chloroethyl)-N,N-diethylpentane-1,5-diamine oxide |
|---|---|
| PubChem CID | 3063980 |
| Molecular Formula | C13H28Cl2N2O2 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | N',N'-bis(2-chloroethyl)-N,N-diethylpentane-1,5-diamine oxide |
| SMILES | CC[N+]([O-])(CC)CCCCC[N+]([O-])(CCCl)CCCl |
| InChI | InChI=1S/C13H28Cl2N2O2/c1-3-16(18,4-2)10-6-5-7-11-17(19,12-8-14)13-9-15/h3-13H2,1-2H3 |
| InChIKey | QMBUFEUULFIIOX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|