C28H42N2O2 — CID 3064083
1,4-bis[1-(4-methoxyphenyl)pentan-3-yl]piperazine (PubChem CID 3064083) has the molecular formula C28H42N2O2 and a molecular weight of 438.66 g/mol. Its IUPAC name is 1,4-bis[1-(4-methoxyphenyl)pentan-3-yl]piperazine.
| Compound Name | 1,4-bis[1-(4-methoxyphenyl)pentan-3-yl]piperazine |
|---|---|
| PubChem CID | 3064083 |
| Molecular Formula | C28H42N2O2 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | 1,4-bis[1-(4-methoxyphenyl)pentan-3-yl]piperazine |
| SMILES | CCC(CCc1ccc(OC)cc1)N1CCN(C(CC)CCc2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C28H42N2O2/c1-5-25(13-7-23-9-15-27(31-3)16-10-23)29-19-21-30(22-20-29)26(6-2)14-8-24-11-17-28(32-4)18-12-24/h9-12,15-18,25-26H,5-8,13-14,19-22H2,1-4H3 |
| InChIKey | FFHQPARIWHXSCX-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |