C18H34N4O2 — CID 30641335
N-tert-butyl-2-[4-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]piperazin-1-yl]acetamide (PubChem CID 30641335) has the molecular formula C18H34N4O2 and a molecular weight of 338.50 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]piperazin-1-yl]acetamide.
| Compound Name | N-tert-butyl-2-[4-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 30641335 |
| Molecular Formula | C18H34N4O2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | N-tert-butyl-2-[4-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]piperazin-1-yl]acetamide |
| SMILES | C[C@@H]1CCCCN1C(=O)CN1CCN(CC(=O)NC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H34N4O2/c1-15-7-5-6-8-22(15)17(24)14-21-11-9-20(10-12-21)13-16(23)19-18(2,3)4/h15H,5-14H2,1-4H3,(H,19,23)/t15-/m1/s1 |
| InChIKey | QBQXOYUCTWAZSA-OAHLLOKOSA-N |
| XLogP | 0.92 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |