C23H23ClOS — CID 3067122
1-chloro-4-[2-methyl-1-[(3-phenylsulfanylphenyl)methoxy]propan-2-yl]benzene (PubChem CID 3067122) has the molecular formula C23H23ClOS and a molecular weight of 382.96 g/mol. Its IUPAC name is 1-chloro-4-[2-methyl-1-[(3-phenylsulfanylphenyl)methoxy]propan-2-yl]benzene.
| Compound Name | 1-chloro-4-[2-methyl-1-[(3-phenylsulfanylphenyl)methoxy]propan-2-yl]benzene |
|---|---|
| PubChem CID | 3067122 |
| Molecular Formula | C23H23ClOS |
| Molecular Weight | 382.96 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 1-chloro-4-[2-methyl-1-[(3-phenylsulfanylphenyl)methoxy]propan-2-yl]benzene |
| SMILES | CC(C)(COCc1cccc(Sc2ccccc2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H23ClOS/c1-23(2,19-11-13-20(24)14-12-19)17-25-16-18-7-6-10-22(15-18)26-21-8-4-3-5-9-21/h3-15H,16-17H2,1-2H3 |
| InChIKey | UQMKJXROQWLADA-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.96 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |