C19H18ClF3OS — CID 118432531
2-(4-chlorophenyl)-2-methyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane (PubChem CID 118432531) has the molecular formula C19H18ClF3OS and a molecular weight of 386.87 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-methyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane.
| Compound Name | 2-(4-chlorophenyl)-2-methyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane |
|---|---|
| PubChem CID | 118432531 |
| Molecular Formula | C19H18ClF3OS |
| Molecular Weight | 386.87 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 2-(4-chlorophenyl)-2-methyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane |
| SMILES | CC1(c2ccc(Cl)cc2)CC(Sc2cccc(C(F)(F)F)c2)CCO1 |
| InChI | InChI=1S/C19H18ClF3OS/c1-18(13-5-7-15(20)8-6-13)12-17(9-10-24-18)25-16-4-2-3-14(11-16)19(21,22)23/h2-8,11,17H,9-10,12H2,1H3 |
| InChIKey | MAKBBCCRCZWXSW-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.87 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |