C12H15N5O — CID 3067263
4-amino-5-methyl-N'-(4-methylphenyl)-1H-pyrazole-3-carbohydrazide (PubChem CID 3067263) has the molecular formula C12H15N5O and a molecular weight of 245.29 g/mol. Its IUPAC name is 4-amino-5-methyl-N'-(4-methylphenyl)-1H-pyrazole-3-carbohydrazide.
| Compound Name | 4-amino-5-methyl-N'-(4-methylphenyl)-1H-pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 3067263 |
| Molecular Formula | C12H15N5O |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 4-amino-5-methyl-N'-(4-methylphenyl)-1H-pyrazole-3-carbohydrazide |
| SMILES | Cc1ccc(NNC(=O)c2n[nH]c(C)c2N)cc1 |
| InChI | InChI=1S/C12H15N5O/c1-7-3-5-9(6-4-7)15-17-12(18)11-10(13)8(2)14-16-11/h3-6,15H,13H2,1-2H3,(H,14,16)(H,17,18) |
| InChIKey | DZKZLUXSSOKXAV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|