C9H6N2O3S2 — CID 3068157
2-oxo-2-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]acetic acid (PubChem CID 3068157) has the molecular formula C9H6N2O3S2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-oxo-2-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]acetic acid.
| Compound Name | 2-oxo-2-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]acetic acid |
|---|---|
| PubChem CID | 3068157 |
| Molecular Formula | C9H6N2O3S2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 253.98 |
| IUPAC Name | 2-oxo-2-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]acetic acid |
| SMILES | O=C(O)C(=O)Nc1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C9H6N2O3S2/c12-7(8(13)14)11-9-10-5(4-16-9)6-2-1-3-15-6/h1-4H,(H,13,14)(H,10,11,12) |
| InChIKey | GADGGECYPDBRQA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|