C24H34N2O2 — CID 30687450
(2S)-1-(4-benzylpiperazin-1-yl)-3-[2-[(2S)-butan-2-yl]phenoxy]propan-2-ol (PubChem CID 30687450) has the molecular formula C24H34N2O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is (2S)-1-(4-benzylpiperazin-1-yl)-3-[2-[(2S)-butan-2-yl]phenoxy]propan-2-ol.
| Compound Name | (2S)-1-(4-benzylpiperazin-1-yl)-3-[2-[(2S)-butan-2-yl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 30687450 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | (2S)-1-(4-benzylpiperazin-1-yl)-3-[2-[(2S)-butan-2-yl]phenoxy]propan-2-ol |
| SMILES | CC[C@H](C)c1ccccc1OC[C@@H](O)CN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H34N2O2/c1-3-20(2)23-11-7-8-12-24(23)28-19-22(27)18-26-15-13-25(14-16-26)17-21-9-5-4-6-10-21/h4-12,20,22,27H,3,13-19H2,1-2H3/t20-,22-/m0/s1 |
| InChIKey | NNLCUWXSTGBFRV-UNMCSNQZSA-N |
| XLogP | 3.76 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |