C21H29ClN2O2S — CID 4880725
1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-3-(2-propan-2-ylphenoxy)propan-2-ol (PubChem CID 4880725) has the molecular formula C21H29ClN2O2S and a molecular weight of 409.00 g/mol. Its IUPAC name is 1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-3-(2-propan-2-ylphenoxy)propan-2-ol.
| Compound Name | 1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-3-(2-propan-2-ylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 4880725 |
| Molecular Formula | C21H29ClN2O2S |
| Molecular Weight | 409.00 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-3-(2-propan-2-ylphenoxy)propan-2-ol |
| SMILES | CC(C)c1ccccc1OCC(O)CN1CCN(Cc2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C21H29ClN2O2S/c1-16(2)19-5-3-4-6-20(19)26-15-17(25)13-23-9-11-24(12-10-23)14-18-7-8-21(22)27-18/h3-8,16-17,25H,9-15H2,1-2H3 |
| InChIKey | LTIQXNWQFWRYDQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.00 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |