About 5-tert-butyl-6,8-dioxa-3-azabicyclo[3.2.1]octane;hydrochloride
5-tert-butyl-6,8-dioxa-3-azabicyclo[3.2.1]octane;hydrochloride (PubChem CID 3069288) has the molecular formula C9H18ClNO2
and a molecular weight of 207.70 g/mol. Its IUPAC name is 5-tert-butyl-6,8-dioxa-3-azabicyclo[3.2.1]octane;hydrochloride.
Molecular Properties
| Compound Name | 5-tert-butyl-6,8-dioxa-3-azabicyclo[3.2.1]octane;hydrochloride |
| PubChem CID | 3069288 |
| Molecular Formula | C9H18ClNO2 |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 5-tert-butyl-6,8-dioxa-3-azabicyclo[3.2.1]octane;hydrochloride |
| SMILES | CC(C)(C)C12CNCC(CO1)O2.Cl |
| InChI | InChI=1S/C9H17NO2.ClH/c1-8(2,3)9-6-10-4-7(12-9)5-11-9;/h7,10H,4-6H2,1-3H3;1H |
| InChIKey | QAYKZMPZXTXYNY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-tert-butyl-6,8-dioxa-3-azabicyclo[3.2.1]octane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-6,8-dioxa-3-azabicyclo[3.2.1]octane;hydrochloride?
The IUPAC name of 5-tert-butyl-6,8-dioxa-3-azabicyclo[3.2.1]octane;hydrochloride (CID 3069288) is 5-tert-butyl-6,8-dioxa-3-azabicyclo[3.2.1]octane;hydrochloride.
What is the SMILES notation for 5-tert-butyl-6,8-dioxa-3-azabicyclo[3.2.1]octane;hydrochloride?
The canonical SMILES for 5-tert-butyl-6,8-dioxa-3-azabicyclo[3.2.1]octane;hydrochloride is CC(C)(C)C12CNCC(CO1)O2.Cl.
What is the InChIKey of 5-tert-butyl-6,8-dioxa-3-azabicyclo[3.2.1]octane;hydrochloride?
The InChIKey is QAYKZMPZXTXYNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.ClH/c1-8(2,3)9-6-10-4-7(12-9)5-11-9;/h7,10H,4-6H2,1-3H3;1H.
What are the key properties of 5-tert-butyl-6,8-dioxa-3-azabicyclo[3.2.1]octane;hydrochloride?
5-tert-butyl-6,8-dioxa-3-azabicyclo[3.2.1]octane;hydrochloride has a molecular weight of 207.70 g/mol, XLogP of 1.17, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-6,8-dioxa-3-azabicyclo[3.2.1]octane;hydrochloride is sourced from PubChem (CID 3069288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).