C28H25N3O2 — CID 30693618
2-(8-methyl-4-oxoquinazolin-3-yl)-N-[[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]acetamide (PubChem CID 30693618) has the molecular formula C28H25N3O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 2-(8-methyl-4-oxoquinazolin-3-yl)-N-[[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]acetamide.
| Compound Name | 2-(8-methyl-4-oxoquinazolin-3-yl)-N-[[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]acetamide |
|---|---|
| PubChem CID | 30693618 |
| Molecular Formula | C28H25N3O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 2-(8-methyl-4-oxoquinazolin-3-yl)-N-[[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]acetamide |
| SMILES | Cc1cccc2c(=O)n(CC(=O)NC[C@@H]3CC4c5ccccc5C3c3ccccc34)cnc12 |
| InChI | InChI=1S/C28H25N3O2/c1-17-7-6-12-23-27(17)30-16-31(28(23)33)15-25(32)29-14-18-13-24-19-8-2-4-10-21(19)26(18)22-11-5-3-9-20(22)24/h2-12,16,18,24,26H,13-15H2,1H3,(H,29,32)/t18-,24?,26?/m0/s1 |
| InChIKey | AROBWRWRQNDCAT-UBSBWAOCSA-N |
| XLogP | 4.12 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |