C22H20N6O4 — CID 30693711
2-[1-(3,5-dimethylphenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]-N-(2-methyl-5-nitrophenyl)acetamide (PubChem CID 30693711) has the molecular formula C22H20N6O4 and a molecular weight of 432.44 g/mol. Its IUPAC name is 2-[1-(3,5-dimethylphenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]-N-(2-methyl-5-nitrophenyl)acetamide.
| Compound Name | 2-[1-(3,5-dimethylphenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]-N-(2-methyl-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 30693711 |
| Molecular Formula | C22H20N6O4 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 2-[1-(3,5-dimethylphenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]-N-(2-methyl-5-nitrophenyl)acetamide |
| SMILES | Cc1cc(C)cc(-n2ncc3c(=O)n(CC(=O)Nc4cc([N+](=O)[O-])ccc4C)cnc32)c1 |
| InChI | InChI=1S/C22H20N6O4/c1-13-6-14(2)8-17(7-13)27-21-18(10-24-27)22(30)26(12-23-21)11-20(29)25-19-9-16(28(31)32)5-4-15(19)3/h4-10,12H,11H2,1-3H3,(H,25,29) |
| InChIKey | GEIOUCHACNKGQM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|