C20H16N6O4 — CID 43068176
N-(4-methylphenyl)-2-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]acetamide (PubChem CID 43068176) has the molecular formula C20H16N6O4 and a molecular weight of 404.39 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]acetamide.
| Compound Name | N-(4-methylphenyl)-2-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]acetamide |
|---|---|
| PubChem CID | 43068176 |
| Molecular Formula | C20H16N6O4 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | N-(4-methylphenyl)-2-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2cnc3c(cnn3-c3ccccc3[N+](=O)[O-])c2=O)cc1 |
| InChI | InChI=1S/C20H16N6O4/c1-13-6-8-14(9-7-13)23-18(27)11-24-12-21-19-15(20(24)28)10-22-25(19)16-4-2-3-5-17(16)26(29)30/h2-10,12H,11H2,1H3,(H,23,27) |
| InChIKey | QFXPZMINNRRECJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|