C18H13N7O5S — CID 46426249
2-[[2-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]acetyl]amino]thiophene-3-carboxamide (PubChem CID 46426249) has the molecular formula C18H13N7O5S and a molecular weight of 439.41 g/mol. Its IUPAC name is 2-[[2-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]acetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]acetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 46426249 |
| Molecular Formula | C18H13N7O5S |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | 2-[[2-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]acetyl]amino]thiophene-3-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)Cn1cnc2c(cnn2-c2ccccc2[N+](=O)[O-])c1=O |
| InChI | InChI=1S/C18H13N7O5S/c19-15(27)10-5-6-31-17(10)22-14(26)8-23-9-20-16-11(18(23)28)7-21-24(16)12-3-1-2-4-13(12)25(29)30/h1-7,9H,8H2,(H2,19,27)(H,22,26) |
| InChIKey | DUXYZIIGYGHUHV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 168.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|