C25H18N6O4 — CID 46426265
2-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]-N-(2-phenylphenyl)acetamide (PubChem CID 46426265) has the molecular formula C25H18N6O4 and a molecular weight of 466.46 g/mol. Its IUPAC name is 2-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]-N-(2-phenylphenyl)acetamide.
| Compound Name | 2-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]-N-(2-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 46426265 |
| Molecular Formula | C25H18N6O4 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 2-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]-N-(2-phenylphenyl)acetamide |
| SMILES | O=C(Cn1cnc2c(cnn2-c2ccccc2[N+](=O)[O-])c1=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C25H18N6O4/c32-23(28-20-11-5-4-10-18(20)17-8-2-1-3-9-17)15-29-16-26-24-19(25(29)33)14-27-30(24)21-12-6-7-13-22(21)31(34)35/h1-14,16H,15H2,(H,28,32) |
| InChIKey | GWLICUGTBSSDJP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|