C27H22N6O4 — CID 55643572
N-(1,2-diphenylethyl)-2-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]acetamide (PubChem CID 55643572) has the molecular formula C27H22N6O4 and a molecular weight of 494.51 g/mol. Its IUPAC name is N-(1,2-diphenylethyl)-2-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]acetamide.
| Compound Name | N-(1,2-diphenylethyl)-2-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]acetamide |
|---|---|
| PubChem CID | 55643572 |
| Molecular Formula | C27H22N6O4 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | N-(1,2-diphenylethyl)-2-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]acetamide |
| SMILES | O=C(Cn1cnc2c(cnn2-c2ccccc2[N+](=O)[O-])c1=O)NC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H22N6O4/c34-25(30-22(20-11-5-2-6-12-20)15-19-9-3-1-4-10-19)17-31-18-28-26-21(27(31)35)16-29-32(26)23-13-7-8-14-24(23)33(36)37/h1-14,16,18,22H,15,17H2,(H,30,34) |
| InChIKey | LQBAPIIETUIXSE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|