C19H14BrN5O4 — CID 112840078
5-[2-(3-bromophenyl)-2-hydroxyethyl]-1-(2-nitrophenyl)pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 112840078) has the molecular formula C19H14BrN5O4 and a molecular weight of 456.26 g/mol. Its IUPAC name is 5-[2-(3-bromophenyl)-2-hydroxyethyl]-1-(2-nitrophenyl)pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 5-[2-(3-bromophenyl)-2-hydroxyethyl]-1-(2-nitrophenyl)pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 112840078 |
| Molecular Formula | C19H14BrN5O4 |
| Molecular Weight | 456.26 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | 5-[2-(3-bromophenyl)-2-hydroxyethyl]-1-(2-nitrophenyl)pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1c2cnn(-c3ccccc3[N+](=O)[O-])c2ncn1CC(O)c1cccc(Br)c1 |
| InChI | InChI=1S/C19H14BrN5O4/c20-13-5-3-4-12(8-13)17(26)10-23-11-21-18-14(19(23)27)9-22-24(18)15-6-1-2-7-16(15)25(28)29/h1-9,11,17,26H,10H2 |
| InChIKey | VIEZQLYSBTWNLM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|