C21H16N6O4 — CID 46426295
5-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-1-(2-nitrophenyl)pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 46426295) has the molecular formula C21H16N6O4 and a molecular weight of 416.40 g/mol. Its IUPAC name is 5-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-1-(2-nitrophenyl)pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 5-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-1-(2-nitrophenyl)pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 46426295 |
| Molecular Formula | C21H16N6O4 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 5-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-1-(2-nitrophenyl)pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=C(Cn1cnc2c(cnn2-c2ccccc2[N+](=O)[O-])c1=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C21H16N6O4/c28-19(25-10-9-14-5-1-2-6-16(14)25)12-24-13-22-20-15(21(24)29)11-23-26(20)17-7-3-4-8-18(17)27(30)31/h1-8,11,13H,9-10,12H2 |
| InChIKey | RPLAOFNVLHLSFT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 116.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|