C16H15N5O5 — CID 86992251
methyl 4-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]butanoate (PubChem CID 86992251) has the molecular formula C16H15N5O5 and a molecular weight of 357.33 g/mol. Its IUPAC name is methyl 4-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]butanoate.
| Compound Name | methyl 4-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]butanoate |
|---|---|
| PubChem CID | 86992251 |
| Molecular Formula | C16H15N5O5 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | methyl 4-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]butanoate |
| SMILES | COC(=O)CCCn1cnc2c(cnn2-c2ccccc2[N+](=O)[O-])c1=O |
| InChI | InChI=1S/C16H15N5O5/c1-26-14(22)7-4-8-19-10-17-15-11(16(19)23)9-18-20(15)12-5-2-3-6-13(12)21(24)25/h2-3,5-6,9-10H,4,7-8H2,1H3 |
| InChIKey | XSKBMSJFFRRQQX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 122.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|