C17H19N5O4 — CID 47060502
5-(2-butoxyethyl)-1-(2-nitrophenyl)pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 47060502) has the molecular formula C17H19N5O4 and a molecular weight of 357.37 g/mol. Its IUPAC name is 5-(2-butoxyethyl)-1-(2-nitrophenyl)pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 5-(2-butoxyethyl)-1-(2-nitrophenyl)pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 47060502 |
| Molecular Formula | C17H19N5O4 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 5-(2-butoxyethyl)-1-(2-nitrophenyl)pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCCCOCCn1cnc2c(cnn2-c2ccccc2[N+](=O)[O-])c1=O |
| InChI | InChI=1S/C17H19N5O4/c1-2-3-9-26-10-8-20-12-18-16-13(17(20)23)11-19-21(16)14-6-4-5-7-15(14)22(24)25/h4-7,11-12H,2-3,8-10H2,1H3 |
| InChIKey | JBZXHAFJTDXJQK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 105.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|