C21H17N7O5S — CID 46426251
2-[[2-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]acetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide (PubChem CID 46426251) has the molecular formula C21H17N7O5S and a molecular weight of 479.48 g/mol. Its IUPAC name is 2-[[2-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]acetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide.
| Compound Name | 2-[[2-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]acetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 46426251 |
| Molecular Formula | C21H17N7O5S |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | 2-[[2-[1-(2-nitrophenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]acetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)Cn2cnc3c(cnn3-c3ccccc3[N+](=O)[O-])c2=O)sc2c1CCC2 |
| InChI | InChI=1S/C21H17N7O5S/c22-18(30)17-11-4-3-7-15(11)34-20(17)25-16(29)9-26-10-23-19-12(21(26)31)8-24-27(19)13-5-1-2-6-14(13)28(32)33/h1-2,5-6,8,10H,3-4,7,9H2,(H2,22,30)(H,25,29) |
| InChIKey | PCPUTGANXPMIKI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 168.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|