C20H19N5O4S — CID 30702944
[2-[(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] 4-(1,2,4-triazol-1-yl)benzoate (PubChem CID 30702944) has the molecular formula C20H19N5O4S and a molecular weight of 425.47 g/mol. Its IUPAC name is [2-[(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] 4-(1,2,4-triazol-1-yl)benzoate.
| Compound Name | [2-[(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] 4-(1,2,4-triazol-1-yl)benzoate |
|---|---|
| PubChem CID | 30702944 |
| Molecular Formula | C20H19N5O4S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | [2-[(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] 4-(1,2,4-triazol-1-yl)benzoate |
| SMILES | NC(=O)c1c(NC(=O)COC(=O)c2ccc(-n3cncn3)cc2)sc2c1CCCC2 |
| InChI | InChI=1S/C20H19N5O4S/c21-18(27)17-14-3-1-2-4-15(14)30-19(17)24-16(26)9-29-20(28)12-5-7-13(8-6-12)25-11-22-10-23-25/h5-8,10-11H,1-4,9H2,(H2,21,27)(H,24,26) |
| InChIKey | CEGXUCASLYXNRI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |