C17H19N3O2S — CID 30704688
4-[2-[(5-cyclohexyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]benzonitrile (PubChem CID 30704688) has the molecular formula C17H19N3O2S and a molecular weight of 329.42 g/mol. Its IUPAC name is 4-[2-[(5-cyclohexyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]benzonitrile.
| Compound Name | 4-[2-[(5-cyclohexyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 30704688 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 4-[2-[(5-cyclohexyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCCSc2nnc(C3CCCCC3)o2)cc1 |
| InChI | InChI=1S/C17H19N3O2S/c18-12-13-6-8-15(9-7-13)21-10-11-23-17-20-19-16(22-17)14-4-2-1-3-5-14/h6-9,14H,1-5,10-11H2 |
| InChIKey | RDZAWMRFGFVZMG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 71.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|