C13H23N3O3S — CID 3070480
ethyl 3-[1-[3-(dimethylamino)propyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]propanoate (PubChem CID 3070480) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is ethyl 3-[1-[3-(dimethylamino)propyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]propanoate.
| Compound Name | ethyl 3-[1-[3-(dimethylamino)propyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]propanoate |
|---|---|
| PubChem CID | 3070480 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | ethyl 3-[1-[3-(dimethylamino)propyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]propanoate |
| SMILES | CCOC(=O)CCC1NC(=S)N(CCCN(C)C)C1=O |
| InChI | InChI=1S/C13H23N3O3S/c1-4-19-11(17)7-6-10-12(18)16(13(20)14-10)9-5-8-15(2)3/h10H,4-9H2,1-3H3,(H,14,20) |
| InChIKey | PQBQGGLPLQKVBA-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|