C25H21N3O5S — CID 30706513
3-(2,5-dioxopyrrolidin-1-yl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)benzamide (PubChem CID 30706513) has the molecular formula C25H21N3O5S and a molecular weight of 475.53 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 30706513 |
| Molecular Formula | C25H21N3O5S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)benzamide |
| SMILES | CCOc1ccc2nc(N(Cc3ccco3)C(=O)c3cccc(N4C(=O)CCC4=O)c3)sc2c1 |
| InChI | InChI=1S/C25H21N3O5S/c1-2-32-18-8-9-20-21(14-18)34-25(26-20)27(15-19-7-4-12-33-19)24(31)16-5-3-6-17(13-16)28-22(29)10-11-23(28)30/h3-9,12-14H,2,10-11,15H2,1H3 |
| InChIKey | UJAXKOYNTFYDFC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 92.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|