C27H23N3O3S — CID 41110161
N-benzyl-3-(2,5-dioxopyrrolidin-1-yl)-N-(6-ethyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 41110161) has the molecular formula C27H23N3O3S and a molecular weight of 469.57 g/mol. Its IUPAC name is N-benzyl-3-(2,5-dioxopyrrolidin-1-yl)-N-(6-ethyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | N-benzyl-3-(2,5-dioxopyrrolidin-1-yl)-N-(6-ethyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 41110161 |
| Molecular Formula | C27H23N3O3S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | N-benzyl-3-(2,5-dioxopyrrolidin-1-yl)-N-(6-ethyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCc1ccc2nc(N(Cc3ccccc3)C(=O)c3cccc(N4C(=O)CCC4=O)c3)sc2c1 |
| InChI | InChI=1S/C27H23N3O3S/c1-2-18-11-12-22-23(15-18)34-27(28-22)29(17-19-7-4-3-5-8-19)26(33)20-9-6-10-21(16-20)30-24(31)13-14-25(30)32/h3-12,15-16H,2,13-14,17H2,1H3 |
| InChIKey | CJEVALXKWJEVEZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|