C25H28N4O3S — CID 41347320
N-[3-(dimethylamino)propyl]-3-(2,5-dioxopyrrolidin-1-yl)-N-(6-ethyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 41347320) has the molecular formula C25H28N4O3S and a molecular weight of 464.59 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-3-(2,5-dioxopyrrolidin-1-yl)-N-(6-ethyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-3-(2,5-dioxopyrrolidin-1-yl)-N-(6-ethyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 41347320 |
| Molecular Formula | C25H28N4O3S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-3-(2,5-dioxopyrrolidin-1-yl)-N-(6-ethyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCc1ccc2nc(N(CCCN(C)C)C(=O)c3cccc(N4C(=O)CCC4=O)c3)sc2c1 |
| InChI | InChI=1S/C25H28N4O3S/c1-4-17-9-10-20-21(15-17)33-25(26-20)28(14-6-13-27(2)3)24(32)18-7-5-8-19(16-18)29-22(30)11-12-23(29)31/h5,7-10,15-16H,4,6,11-14H2,1-3H3 |
| InChIKey | ZUAIIPOQEPUQCT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|