C23H25ClN4O3S — CID 44929496
N-(1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-4-(2,5-dioxopyrrolidin-1-yl)benzamide;hydrochloride (PubChem CID 44929496) has the molecular formula C23H25ClN4O3S and a molecular weight of 473.00 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-4-(2,5-dioxopyrrolidin-1-yl)benzamide;hydrochloride.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-4-(2,5-dioxopyrrolidin-1-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 44929496 |
| Molecular Formula | C23H25ClN4O3S |
| Molecular Weight | 473.00 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-4-(2,5-dioxopyrrolidin-1-yl)benzamide;hydrochloride |
| SMILES | CN(C)CCCN(C(=O)c1ccc(N2C(=O)CCC2=O)cc1)c1nc2ccccc2s1.Cl |
| InChI | InChI=1S/C23H24N4O3S.ClH/c1-25(2)14-5-15-26(23-24-18-6-3-4-7-19(18)31-23)22(30)16-8-10-17(11-9-16)27-20(28)12-13-21(27)29;/h3-4,6-11H,5,12-15H2,1-2H3;1H |
| InChIKey | XEPYOFJAJMTGTA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.00 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|