C24H18N4O3S — CID 41004770
N-(1,3-benzothiazol-2-yl)-3-(2,5-dioxopyrrolidin-1-yl)-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 41004770) has the molecular formula C24H18N4O3S and a molecular weight of 442.50 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-3-(2,5-dioxopyrrolidin-1-yl)-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-3-(2,5-dioxopyrrolidin-1-yl)-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 41004770 |
| Molecular Formula | C24H18N4O3S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-3-(2,5-dioxopyrrolidin-1-yl)-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | O=C(c1cccc(N2C(=O)CCC2=O)c1)N(Cc1ccccn1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C24H18N4O3S/c29-21-11-12-22(30)28(21)18-8-5-6-16(14-18)23(31)27(15-17-7-3-4-13-25-17)24-26-19-9-1-2-10-20(19)32-24/h1-10,13-14H,11-12,15H2 |
| InChIKey | WQSHADTYMVPYMF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|