C27H23N3O5S — CID 41115404
N-benzyl-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-3-(2,5-dioxopyrrolidin-1-yl)benzamide (PubChem CID 41115404) has the molecular formula C27H23N3O5S and a molecular weight of 501.56 g/mol. Its IUPAC name is N-benzyl-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-3-(2,5-dioxopyrrolidin-1-yl)benzamide.
| Compound Name | N-benzyl-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-3-(2,5-dioxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 41115404 |
| Molecular Formula | C27H23N3O5S |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | N-benzyl-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-3-(2,5-dioxopyrrolidin-1-yl)benzamide |
| SMILES | COc1ccc(OC)c2sc(N(Cc3ccccc3)C(=O)c3cccc(N4C(=O)CCC4=O)c3)nc12 |
| InChI | InChI=1S/C27H23N3O5S/c1-34-20-11-12-21(35-2)25-24(20)28-27(36-25)29(16-17-7-4-3-5-8-17)26(33)18-9-6-10-19(15-18)30-22(31)13-14-23(30)32/h3-12,15H,13-14,16H2,1-2H3 |
| InChIKey | ZFTDXYKIYFDCPW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|