C19H12F2N2O2S2 — CID 30708695
(E)-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 30708695) has the molecular formula C19H12F2N2O2S2 and a molecular weight of 402.45 g/mol. Its IUPAC name is (E)-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 30708695 |
| Molecular Formula | C19H12F2N2O2S2 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | (E)-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccs1)N(Cc1ccco1)c1nc2c(F)cc(F)cc2s1 |
| InChI | InChI=1S/C19H12F2N2O2S2/c20-12-9-15(21)18-16(10-12)27-19(22-18)23(11-13-3-1-7-25-13)17(24)6-5-14-4-2-8-26-14/h1-10H,11H2/b6-5+ |
| InChIKey | CRNOCNJZDATLHC-AATRIKPKSA-N |
| XLogP | 5.48 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|