C21H18N2O2S2 — CID 30713222
(E)-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 30713222) has the molecular formula C21H18N2O2S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is (E)-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 30713222 |
| Molecular Formula | C21H18N2O2S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | (E)-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | Cc1cc2nc(N(Cc3ccco3)C(=O)/C=C/c3cccs3)sc2cc1C |
| InChI | InChI=1S/C21H18N2O2S2/c1-14-11-18-19(12-15(14)2)27-21(22-18)23(13-16-5-3-9-25-16)20(24)8-7-17-6-4-10-26-17/h3-12H,13H2,1-2H3/b8-7+ |
| InChIKey | OFUCSTBZIVMPOV-BQYQJAHWSA-N |
| XLogP | 5.81 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|