C23H19N3O4S — CID 30710209
(Z)-N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 30710209) has the molecular formula C23H19N3O4S and a molecular weight of 433.49 g/mol. Its IUPAC name is (Z)-N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 30710209 |
| Molecular Formula | C23H19N3O4S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | (Z)-N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | Cc1ccc(C)c2sc(N(Cc3ccco3)C(=O)/C=C\c3ccc([N+](=O)[O-])cc3)nc12 |
| InChI | InChI=1S/C23H19N3O4S/c1-15-5-6-16(2)22-21(15)24-23(31-22)25(14-19-4-3-13-30-19)20(27)12-9-17-7-10-18(11-8-17)26(28)29/h3-13H,14H2,1-2H3/b12-9- |
| InChIKey | WEORRDVNALLROM-XFXZXTDPSA-N |
| XLogP | 5.66 |
| TPSA | 89.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|