C22H16ClN3O4S — CID 30711451
(E)-N-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 30711451) has the molecular formula C22H16ClN3O4S and a molecular weight of 453.91 g/mol. Its IUPAC name is (E)-N-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 30711451 |
| Molecular Formula | C22H16ClN3O4S |
| Molecular Weight | 453.91 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | (E)-N-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | Cc1ccc(Cl)c2sc(N(Cc3ccco3)C(=O)/C=C/c3cccc([N+](=O)[O-])c3)nc12 |
| InChI | InChI=1S/C22H16ClN3O4S/c1-14-7-9-18(23)21-20(14)24-22(31-21)25(13-17-6-3-11-30-17)19(27)10-8-15-4-2-5-16(12-15)26(28)29/h2-12H,13H2,1H3/b10-8+ |
| InChIKey | HNCLKWSYFNQJPV-CSKARUKUSA-N |
| XLogP | 6.01 |
| TPSA | 89.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.91 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|