C36H41F2N3O — CID 3072766
1-(N-benzylanilino)-3-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]propan-2-ol (PubChem CID 3072766) has the molecular formula C36H41F2N3O and a molecular weight of 569.74 g/mol. Its IUPAC name is 1-(N-benzylanilino)-3-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]propan-2-ol.
| Compound Name | 1-(N-benzylanilino)-3-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 3072766 |
| Molecular Formula | C36H41F2N3O |
| Molecular Weight | 569.74 g/mol |
| Exact Mass | 569.32 |
| IUPAC Name | 1-(N-benzylanilino)-3-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]propan-2-ol |
| SMILES | OC(CN1CCN(CCCC(c2ccc(F)cc2)c2ccc(F)cc2)CC1)CN(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H41F2N3O/c37-32-17-13-30(14-18-32)36(31-15-19-33(38)20-16-31)12-7-21-39-22-24-40(25-23-39)27-35(42)28-41(34-10-5-2-6-11-34)26-29-8-3-1-4-9-29/h1-6,8-11,13-20,35-36,42H,7,12,21-28H2 |
| InChIKey | QFSSEKVIZBZQMA-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.74 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |