C16H20N2O4 — CID 30736250
(3S)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]oxolan-2-one (PubChem CID 30736250) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is (3S)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]oxolan-2-one.
| Compound Name | (3S)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]oxolan-2-one |
|---|---|
| PubChem CID | 30736250 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (3S)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]oxolan-2-one |
| SMILES | O=C1OCC[C@@H]1N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C16H20N2O4/c19-16-13(3-8-20-16)18-6-4-17(5-7-18)10-12-1-2-14-15(9-12)22-11-21-14/h1-2,9,13H,3-8,10-11H2/t13-/m0/s1 |
| InChIKey | WLILDUWFMAVEEE-ZDUSSCGKSA-N |
| XLogP | 0.85 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |