C19H23N3O4 — CID 42929925
3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-1-cyclopropylpyrrolidine-2,5-dione (PubChem CID 42929925) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-1-cyclopropylpyrrolidine-2,5-dione.
| Compound Name | 3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-1-cyclopropylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 42929925 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-1-cyclopropylpyrrolidine-2,5-dione |
| SMILES | O=C1CC(N2CCN(Cc3ccc4c(c3)OCO4)CC2)C(=O)N1C1CC1 |
| InChI | InChI=1S/C19H23N3O4/c23-18-10-15(19(24)22(18)14-2-3-14)21-7-5-20(6-8-21)11-13-1-4-16-17(9-13)26-12-25-16/h1,4,9,14-15H,2-3,5-8,10-12H2 |
| InChIKey | XUWZANWXADAUSL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|