C16H17N5O2S — CID 30746930
N'-(4,6-dimethylpyrimidin-2-yl)-3-methylquinoline-8-sulfonohydrazide (PubChem CID 30746930) has the molecular formula C16H17N5O2S and a molecular weight of 343.41 g/mol. Its IUPAC name is N'-(4,6-dimethylpyrimidin-2-yl)-3-methylquinoline-8-sulfonohydrazide.
| Compound Name | N'-(4,6-dimethylpyrimidin-2-yl)-3-methylquinoline-8-sulfonohydrazide |
|---|---|
| PubChem CID | 30746930 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N'-(4,6-dimethylpyrimidin-2-yl)-3-methylquinoline-8-sulfonohydrazide |
| SMILES | Cc1cnc2c(S(=O)(=O)NNc3nc(C)cc(C)n3)cccc2c1 |
| InChI | InChI=1S/C16H17N5O2S/c1-10-7-13-5-4-6-14(15(13)17-9-10)24(22,23)21-20-16-18-11(2)8-12(3)19-16/h4-9,21H,1-3H3,(H,18,19,20) |
| InChIKey | CSHZWHLWSVBMOV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|